VZ25864
VZ25864 3,5-DINITROBENZOTRIFLUORIDE
|
| Product Name |
3,5-DINITROBENZOTRIFLUORIDE |
| Catalog No. |
VZ25864 |
| CAS No. |
401-99-0 |
| Molecular Formula |
C7H3N2O4F3 |
| Molecular Weight |
236.10492 |
|
| Synonyms |
1,3-Dinitro-5-(trifluoromethyl)-benzene |
| Smile Code |
O=[N+]([O-])C1C=C(C=C([N+](=O)[O-])C=1)C(F)(F)F |
| InChI |
InChI=1S/C7H3F3N2O4/c8-7(9,10)4-1-5(11(13)14)3-6(2-4)12(15)16/h1-3H |
| EINECS |
206-935-2 |
| Density |
|
| Melting point |
|
| Boiling point |
|
| Refractive index |
|
| Water solubility |
|
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
Bulk Quote Request