|
|
| Synonyms | (3,4-toluenedithiolato(2-))zinc hydrate; [3,4-Toluenedithiolato(2-)]zinc hydrate |
| Smile Code | O.[Zn+2].CC1=CC([S-])=C([S-])C=C1 |
| InChI | InChI=1S/C7H8S2.H2O.Zn/c1-5-2-3-6(8)7(9)4-5;;/h2-4,8-9H,1H3;1H2;/q;;+2/p-2 |
| EINECS | |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |