|
|
| Synonyms | 3-FLUORO-4-CHLOROACETOPHENONE; 4'-CHLORO-3'-FLUOROACETOPHENONE |
| Smile Code | CC(=O)C1=CC(F)=C(Cl)C=C1 |
| InChI | InChI=1S/C8H6ClFO/c1-5(11)6-2-3-7(9)8(10)4-6/h2-4H,1H3 |
| EINECS | |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |