|
|
| Synonyms | 4-Bromophenyl ethyl ether; 4-Bromoethoxybenzene |
| Smile Code | CCOC1=CC=C(Br)C=C1 |
| InChI | InChI=1S/C8H9BrO/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
| EINECS | 209-629-7 |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |