|
|
| Synonyms | (4-Bromophenoxy)acetic acid; 4-Bromophenoxyacetic acid; |
| Smile Code | OC(=O)COC1=CC=C(Br)C=C1 |
| InChI | InChI=1S/C8H7BrO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) |
| EINECS | 217-530-5 |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |