|
|
| Synonyms | 4-bromobenzyl cyanide; Benzeneacetonitrile, 4-bromo-; |
| Smile Code | N#CCC1=CC=C(Br)C=C1 |
| InChI | InChI=1S/C8H6BrN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
| EINECS | 240-602-2 |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |