VZ20130
VZ20130 (4-CHLOROBENZENESULPHONYL)ACETONTRILE
|
| Product Name |
(4-CHLOROBENZENESULPHONYL)ACETONTRILE |
| Catalog No. |
VZ20130 |
| CAS No. |
1851-09-8 |
| Molecular Formula |
C8H6NO2Scl |
| Molecular Weight |
215.65674 |
|
| Synonyms |
(4-Chlorobenzenesulphonyl)acetonitrile; (4-Chlorophenylsulphonyl)acetonitrile |
| Smile Code |
N#CCS(=O)(=O)C1=CC=C(Cl)C=C1 |
| InChI |
InChI=1S/C8H6ClNO2S/c9-7-1-3-8(4-2-7)13(11,12)6-5-10/h1-4H,6H2 |
| EINECS |
|
| Density |
|
| Melting point |
|
| Boiling point |
|
| Refractive index |
|
| Water solubility |
|
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
Bulk Quote Request