|
|
| Synonyms | 2-Naphthoic acid methyl ester |
| Smile Code | COC(=O)C1=CC2C(=CC=CC=2)C=C1 |
| InChI | InChI=1S/C12H10O2/c1-14-12(13)11-7-6-9-4-2-3-5-10(9)8-11/h2-8H,1H3 |
| EINECS | |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |