|
|
| Synonyms | methyl 3-(methylamino)but-2-enoate |
| Smile Code | CN\C(C)=C\C(=O)OC |
| InChI | InChI=1S/C6H11NO2/c1-5(7-2)4-6(8)9-3/h4,7H,1-3H3/b5-4+ |
| EINECS | |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |