|
|
| Synonyms | 4-(trans-4-pentylcyclohexyl)benzoic acid |
| Smile Code | CCCCCC1CCC(CC1)C2=CC=C(C(O)=O)C=C2 |
| InChI | InChI=1S/C18H26O2/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(19)20/h10-15H,2-9H2,1H3,(H,19,20) |
| EINECS | |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |