|
|
| Synonyms | 3-Methoxy-5-(trifluoromethyl)aniline |
| Smile Code | COC1=CC(=CC(N)=C1)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO/c1-13-7-3-5(8(9,10)11)2-6(12)4-7/h2-4H,12H2,1H3 |
| EINECS | 206-487-8 |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |