|
|
| Synonyms | - |
| Smile Code | NC(=O)C1=C(C=C(C=C1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F6NO/c10-8(11,12)4-1-2-5(7(16)17)6(3-4)9(13,14)15/h1-3H,(H2,16,17) |
| EINECS | |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |