|
|
| Synonyms | |
| Smile Code | CC1=CC=C(C=C1)S(F)(F)CC(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6S/c1-7-2-4-8(5-3-7)17(15,16)6-9(11)10(12,13)14/h2-5,9H,6H2,1H3 |
| EINECS | |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |