|
|
| Synonyms | 1-Carboxamido-3,5-dimethylpyrazole; 3,5-Dimethyl-1H-pyrazole-1-carboxamide |
| Smile Code | NC(=O)N1C(C)=CC(C)=N1 |
| InChI | InChI=1S/C6H9N3O/c1-4-3-5(2)9(8-4)6(7)10/h3H,1-2H3,(H2,7,10) |
| EINECS | 213-283-2 |
| Density | |
| Melting point | |
| Boiling point | |
| Refractive index | |
| Water solubility | |
| Hazard Symbols | |
| Risk Codes | |
| Safety Description |